Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (755) 3323-9182 ex 801 802 // +86 13424336463 | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Ethoxy-6-Nitro-1,3-Benzodioxole |
|---|---|
| Synonyms | 1,3-Benzodioxole, 4-ethoxy-6-nitro-; 4-Ethoxy-6-nitro-1,3-benzodioxol |
| Molecular Structure |  |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 |
| CAS Registry Number | 114426-30-1 |
| SMILES | CCOc1cc(cc2c1OCO2)[N+](=O)[O-] |
| InChI | 1S/C9H9NO5/c1-2-13-7-3-6(10(11)12)4-8-9(7)15-5-14-8/h3-4H,2,5H2,1H3 |
| InChIKey | KVFIQUSVDUMCON-UHFFFAOYSA-N |
| Desity | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 160.2±29.9°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethoxy-6-Nitro-1,3-Benzodioxole |