|
CAS#: 114485-92-6 Product: Pidolacetamol No suppilers available for the product. |
| Name | Pidolacetamol |
|---|---|
| Synonyms | (2S)-5-Oxo-2-Pyrrolidinecarboxylic Acid (4-Acetamidophenyl) Ester; (2S)-5-Ketopyrrolidine-2-Carboxylic Acid (4-Acetamidophenyl) Ester; 5-Oxo-L-Proline, Ester With 4'-Hydroxyacetanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 |
| CAS Registry Number | 114485-92-6 |
| SMILES | [C@H]2(C(OC1=CC=C(NC(C)=O)C=C1)=O)NC(=O)CC2 |
| InChI | 1S/C13H14N2O4/c1-8(16)14-9-2-4-10(5-3-9)19-13(18)11-6-7-12(17)15-11/h2-5,11H,6-7H2,1H3,(H,14,16)(H,15,17)/t11-/m0/s1 |
| InChIKey | MLJROESCSXWNAJ-NSHDSACASA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.855°C at 760 mmHg (Cal.) |
| Flash point | 303.881°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pidolacetamol |