Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (755) 3323-9182 ex 801 802 // +86 13424336463 | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Isopropoxy-4-Nitropyridine 1-Oxide |
|---|---|
| Synonyms | 3-isopropoxy-4-nitropyridine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 |
| CAS Registry Number | 114549-64-3 |
| SMILES | CC(C)Oc1c[n+](ccc1[N+](=O)[O-])[O-] |
| InChI | 1S/C8H10N2O4/c1-6(2)14-8-5-9(11)4-3-7(8)10(12)13/h3-6H,1-2H3 |
| InChIKey | MVFXFRFRZKJDQK-UHFFFAOYSA-N |
| Desity | 1.312g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.065°C at 760 mmHg (Cal.) |
| Flash point | 207.243°C (Cal.) |
| Refractive index | 1.553 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Isopropoxy-4-Nitropyridine 1-Oxide |