|
CAS#: 114607-20-4 Product: Sitophilate No suppilers available for the product. |
| Name | Sitophilate |
|---|---|
| Synonyms | 1-Ethylpropyl (2S,3R)-3-Hydroxy-2-Methyl-Pentanoate; (2S,3R)-3-Hydroxy-2-Methylpentanoic Acid 1-Ethylpropyl Ester; (2S,3R)-3-Hydroxy-2-Methyl-Valeric Acid 1-Ethylpropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 |
| CAS Registry Number | 114607-20-4 |
| SMILES | [C@@H](C(OC(CC)CC)=O)([C@H](O)CC)C |
| InChI | 1S/C11H22O3/c1-5-9(6-2)14-11(13)8(4)10(12)7-3/h8-10,12H,5-7H2,1-4H3/t8-,10+/m0/s1 |
| InChIKey | JZOCRUBSQNZLIW-WCBMZHEXSA-N |
| Density | 0.953g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.443°C at 760 mmHg (Cal.) |
| Flash point | 108.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sitophilate |