|
CAS#: 1147-97-3 Product: N-Ethyl-N-[(5-Nitro-1H-Indol-3-Yl)Methyl]Ethanamine No suppilers available for the product. |
| Name | N-Ethyl-N-[(5-Nitro-1H-Indol-3-Yl)Methyl]Ethanamine |
|---|---|
| Synonyms | Diethyl-[(5-Nitro-1H-Indol-3-Yl)Methyl]Amine; Brn 0486245; Indole, 3-((Diethylamino)Methyl)-5-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 |
| CAS Registry Number | 1147-97-3 |
| SMILES | C1=C(C=CC2=C1C(=C[NH]2)CN(CC)CC)[N+](=O)[O-] |
| InChI | 1S/C13H17N3O2/c1-3-15(4-2)9-10-8-14-13-6-5-11(16(17)18)7-12(10)13/h5-8,14H,3-4,9H2,1-2H3 |
| InChIKey | GXZBKAKDGAAGIW-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.561°C at 760 mmHg (Cal.) |
| Flash point | 196.053°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-N-[(5-Nitro-1H-Indol-3-Yl)Methyl]Ethanamine |