| Alsachim SAS | France | Inquire | ||
|---|---|---|---|---|
![]() |
+33 (368) 240-080 | |||
![]() |
contact@alsachim.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | Carvedilol beta-D-Glucuronide |
|---|---|
| Synonyms | Carvedilol & β; -D-Glucuronide (mixture of diasteromers); Carvedilol β-D-Glucuronide |
| Molecular Structure | ![]() |
| Molecular Formula | C30H34N2O10 |
| Molecular Weight | 582.60 |
| CAS Registry Number | 114869-83-9 |
| SMILES | COc1ccccc1OCCNCC(COc2cccc3c2c4ccccc4[nH]3)O[C@H]5[C@H]([C@H]([C@@H](C(O5)C(=O)O)O)O)O |
| InChI | 1S/C30H34N2O10/c1-38-21-10-4-5-11-22(21)39-14-13-31-15-17(41-30-27(35)25(33)26(34)28(42-30)29(36)37)16-40-23-12-6-9-20-24(23)18-7-2-3-8-19(18)32-20/h2-12,17,25-28,30-35H,13-16H2,1H3,(H,36,37)/t17?,25-,26-,27-,28?,30+/m0/s1 |
| InChIKey | PUVQFGCELBOSRN-HEJFJQCXSA-N |
| Density | 1.46g/cm3 (Cal.) |
|---|---|
| Boiling point | 880.86°C at 760 mmHg (Cal.) |
| Flash point | 486.527°C (Cal.) |
| Refractive index | 1.69 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carvedilol beta-D-Glucuronide |