|
CAS#: 114886-35-0 Product: 4-Methyl-3-(2-Phenylethyl)-1,2,4-Oxadiazol-5-One No suppilers available for the product. |
| Name | 4-Methyl-3-(2-Phenylethyl)-1,2,4-Oxadiazol-5-One |
|---|---|
| Synonyms | 3-(2-Phenylethyl)-4-Methylsydnone; Pems; Sydnone, 4-Methyl-3-(2-Phenylethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 |
| CAS Registry Number | 114886-35-0 |
| SMILES | [O+]1=C([N](C(=N1)CCC2=CC=CC=C2)C)[O-] |
| InChI | 1S/C11H12N2O2/c1-13-10(12-15-11(13)14)8-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | BUCXEFZXWKUCCY-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.456°C at 760 mmHg (Cal.) |
| Flash point | 129.463°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-3-(2-Phenylethyl)-1,2,4-Oxadiazol-5-One |