|
CAS#: 115141-47-4 Product: Dercitin No suppilers available for the product. |
| Name | Dercitin |
|---|---|
| Synonyms | Brn 4886720; Dercitin; Dercitine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H20N4S |
| Molecular Weight | 360.48 |
| CAS Registry Number | 115141-47-4 |
| SMILES | C5=NC1=C(C3=C2C(=C1CCN(C)C)N=C4C(=C2C=CN3C)C=CC=C4)S5 |
| InChI | 1S/C21H20N4S/c1-24(2)10-8-15-18-17-14(13-6-4-5-7-16(13)23-18)9-11-25(3)20(17)21-19(15)22-12-26-21/h4-7,9,11-12H,8,10H2,1-3H3 |
| InChIKey | COKHRCLLFPZOEI-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.825°C at 760 mmHg (Cal.) |
| Flash point | 303.863°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dercitin |