|
CAS#: 115219-90-4 Product: Lentinellic Acid No suppilers available for the product. |
| Name | Lentinellic Acid |
|---|---|
| Synonyms | Lentinellic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 |
| CAS Registry Number | 115219-90-4 |
| SMILES | [C@@]24(C(=C1C(OC(C(=C1)C(=O)O)=O)C3CC(C[C@H]23)(C)C)C(C4)=O)C |
| InChI | 1S/C18H20O5/c1-17(2)5-10-11(6-17)18(3)7-12(19)13(18)8-4-9(15(20)21)16(22)23-14(8)10/h4,10-11,14H,5-7H2,1-3H3,(H,20,21)/t10?,11-,14?,18+/m0/s1 |
| InChIKey | JMNIXMWRRYDXON-USFPHPMWSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.81°C at 760 mmHg (Cal.) |
| Flash point | 191.205°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lentinellic Acid |