|
CAS#: 115266-92-7 Product: (5Z)-7-{(1R,2S,3S,4S)-3-[(Phenylsulfonyl)Amino]Bicyclo[2.2.1]Hept-2-Yl}-5-Heptenoic Acid No suppilers available for the product. |
| Name | (5Z)-7-{(1R,2S,3S,4S)-3-[(Phenylsulfonyl)Amino]Bicyclo[2.2.1]Hept-2-Yl}-5-Heptenoic Acid |
|---|---|
| Synonyms | 5,7-(3-ph |
| Molecular Structure | ![]() |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.50 |
| CAS Registry Number | 115266-92-7 |
| SMILES | C1C[C@H]2C[C@@H]1[C@@H]([C@H]2NS(=O)(=O)C3=CC=CC=C3)C/C=C\CCCC(=O)O |
| InChI | 1S/C20H27NO4S/c22-19(23)11-7-2-1-6-10-18-15-12-13-16(14-15)20(18)21-26(24,25)17-8-4-3-5-9-17/h1,3-6,8-9,15-16,18,20-21H,2,7,10-14H2,(H,22,23)/b6-1-/t15-,16+,18+,20+/m1/s1 |
| InChIKey | PWTCIBWRMQFJBC-ZEMKZVSASA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.4±42.0°C at 760 mmHg (Cal.) |
| Flash point | 294.5±27.9°C (Cal.) |
| Refractive index | 1.595 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5Z)-7-{(1R,2S,3S,4S)-3-[(Phenylsulfonyl)Amino]Bicyclo[2.2.1]Hept-2-Yl}-5-Heptenoic Acid |