|
CAS#: 1153-30-6 Product: (4-Nitrophenyl) Dipropyl Phosphate No suppilers available for the product. |
| Name | (4-Nitrophenyl) Dipropyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid (4-Nitrophenyl) Dipropyl Ester; 4-06-00-01328 (Beilstein Handbook Reference); Bay 55640 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18NO6P |
| Molecular Weight | 303.25 |
| CAS Registry Number | 1153-30-6 |
| SMILES | C1=C(O[P](OCCC)(OCCC)=O)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C12H18NO6P/c1-3-9-17-20(16,18-10-4-2)19-12-7-5-11(6-8-12)13(14)15/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | POTZVFXXLZRGAU-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.763°C at 760 mmHg (Cal.) |
| Flash point | 179.846°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Nitrophenyl) Dipropyl Phosphate |