|
CAS#: 115473-37-5 Product: N-Acetyl-S-(2-Carboxyethyl)Cysteine Sulfoxide No suppilers available for the product. |
| Name | N-Acetyl-S-(2-Carboxyethyl)Cysteine Sulfoxide |
|---|---|
| Synonyms | (2R)-2-Acetamido-3-(2-Carboxyethylsulfinyl)Propionic Acid; L-Alanine, N-Acetyl-3-((2-Carboxyethyl)Sulfinyl)-; N-Acetyl-S-(2-Carboxyethyl)Cysteine Sulfoxide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13NO6S |
| Molecular Weight | 251.25 |
| CAS Registry Number | 115473-37-5 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)C[S](=O)CCC(=O)O |
| InChI | 1S/C8H13NO6S/c1-5(10)9-6(8(13)14)4-16(15)3-2-7(11)12/h6H,2-4H2,1H3,(H,9,10)(H,11,12)(H,13,14)/t6-,16?/m0/s1 |
| InChIKey | MIANMZBSGSPFQC-AIUXZDRISA-N |
| Density | 1.517g/cm3 (Cal.) |
|---|---|
| Boiling point | 709.174°C at 760 mmHg (Cal.) |
| Flash point | 382.695°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-S-(2-Carboxyethyl)Cysteine Sulfoxide |