|
CAS#: 115545-59-0 Product: 1-Adamantylaspartate No suppilers available for the product. |
| Name | 1-Adamantylaspartate |
|---|---|
| Synonyms | (2S)-4-(1-Adamantyloxy)-2-Amino-4-Oxo-Butanoic Acid; (2S)-4-(1-Adamantyloxy)-2-Amino-4-Keto-Butyric Acid; 1-Adamantylaspartate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 |
| CAS Registry Number | 115545-59-0 |
| SMILES | [C@H](CC(OC13CC2CC(C1)CC(C2)C3)=O)(C(=O)O)N |
| InChI | 1S/C14H21NO4/c15-11(13(17)18)4-12(16)19-14-5-8-1-9(6-14)3-10(2-8)7-14/h8-11H,1-7,15H2,(H,17,18)/t8?,9?,10?,11-,14?/m0/s1 |
| InChIKey | JWPBQLVAJXYMGD-RLFZITJJSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.759°C at 760 mmHg (Cal.) |
| Flash point | 219.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Adamantylaspartate |