|
CAS#: 115930-43-3 Product: Androsta-4,6,8(9)-Triene-3,17-Dione No suppilers available for the product. |
| Name | Androsta-4,6,8(9)-Triene-3,17-Dione |
|---|---|
| Synonyms | (10S,13S,14S)-10,13-Dimethyl-2,11,12,14,15,16-Hexahydro-1H-Cyclopenta[A]Phenanthrene-3,17-Quinone; Androsta-4,6,8(9)-Triene-3,17-Dione; Androsta-4,6,8-Triene-3,17-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 |
| CAS Registry Number | 115930-43-3 |
| SMILES | [C@H]12[C@@](C(=O)CC1)(CCC3=C2C=CC4=CC(=O)CC[C@]34C)C |
| InChI | 1S/C19H22O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,11,15H,5-10H2,1-2H3/t15-,18-,19-/m0/s1 |
| InChIKey | IVSWIZWRBZUXRO-SNRMKQJTSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.74°C at 760 mmHg (Cal.) |
| Flash point | 180.064°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Androsta-4,6,8(9)-Triene-3,17-Dione |