|
CAS#: 115974-73-7 Product: 1-Phospho-2,3-Diketo-5-S-Methylthiopentane No suppilers available for the product. |
| Name | 1-Phospho-2,3-Diketo-5-S-Methylthiopentane |
|---|---|
| Synonyms | (5-Methylsulfanyl-2,3-Dioxo-Pentyl) Dihydrogen Phosphate; [5-(Methylthio)-2,3-Dioxopentyl] Dihydrogen Phosphate; [2,3-Diketo-5-(Methylthio)Pentyl] Dihydrogen Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11O6PS |
| Molecular Weight | 242.18 |
| CAS Registry Number | 115974-73-7 |
| SMILES | C(C(C(CCSC)=O)=O)O[P](=O)(O)O |
| InChI | 1S/C6H11O6PS/c1-14-3-2-5(7)6(8)4-12-13(9,10)11/h2-4H2,1H3,(H2,9,10,11) |
| InChIKey | HKEAOVFNWRDVAJ-UHFFFAOYSA-N |
| Density | 1.501g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.058°C at 760 mmHg (Cal.) |
| Flash point | 203.611°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phospho-2,3-Diketo-5-S-Methylthiopentane |