|
CAS#: 116-56-3 Product: 20,21-Dihydroxypregn-4-Ene-3,11-Dione No suppilers available for the product. |
| Name | 20,21-Dihydroxypregn-4-Ene-3,11-Dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.46 |
| CAS Registry Number | 116-56-3 |
| SMILES | OCC(O)[C@H]3CC[C@H]2[C@@H]4CC/C1=C/C(=O)CC[C@]1(C)[C@H]4C(=O)C[C@@]23C |
| InChI | 1S/C21H30O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-16,18-19,22,25H,3-8,10-11H2,1-2H3/t14-,15-,16+,18?,19+,20-,21-/m0/s1 |
| InChIKey | UJDLFLAJWMSLEB-RGCRHRMLSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.251°C at 760 mmHg (Cal.) |
| Flash point | 300.642°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 20,21-Dihydroxypregn-4-Ene-3,11-Dione |