|
CAS#: 1161-45-1 Product: Phenyl-(4-Phenyldiazenylphenyl)Diazene No suppilers available for the product. |
| Name | Phenyl-(4-Phenyldiazenylphenyl)Diazene |
|---|---|
| Synonyms | Phenyl-(4-Phenylazophenyl)Diazene; Azobenzene, 4-(Phenylazo)-; Diazene, 1,1'-(1,4-Phenylene)Bis[2-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14N4 |
| Molecular Weight | 286.34 |
| CAS Registry Number | 1161-45-1 |
| SMILES | C2=C(N=NC1=CC=CC=C1)C=CC(=C2)N=NC3=CC=CC=C3 |
| InChI | 1S/C18H14N4/c1-3-7-15(8-4-1)19-21-17-11-13-18(14-12-17)22-20-16-9-5-2-6-10-16/h1-14H |
| InChIKey | QLYZYCHWGGSYBD-UHFFFAOYSA-N |
| Density | 1.12g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.985°C at 760 mmHg (Cal.) |
| Flash point | 225.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl-(4-Phenyldiazenylphenyl)Diazene |