|
CAS#: 116170-30-0 Product: 3-Chloro-5-Ethylsulfinyl-Thiophene-2,4-Dicarbonitrile No suppilers available for the product. |
| Name | 3-Chloro-5-Ethylsulfinyl-Thiophene-2,4-Dicarbonitrile |
|---|---|
| Synonyms | thicyofen |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5ClN2OS2 |
| Molecular Weight | 244.72 |
| CAS Registry Number | 116170-30-0 |
| SMILES | N#Cc1c(Cl)c(C#N)sc1S(=O)CC |
| InChI | 1S/C8H5ClN2OS2/c1-2-14(12)8-5(3-10)7(9)6(4-11)13-8/h2H2,1H3 |
| InChIKey | GNOOAFGERMHQJE-UHFFFAOYSA-N |
| Density | 1.586g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.76°C at 760 mmHg (Cal.) |
| Flash point | 242.136°C (Cal.) |
| Refractive index | 1.66 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-5-Ethylsulfinyl-Thiophene-2,4-Dicarbonitrile |