|
CAS#: 116271-41-1 Product: N,N-Didesmethyleclanamine No suppilers available for the product. |
| Name | N,N-Didesmethyleclanamine |
|---|---|
| Synonyms | N-[(1R,2R)-2-Aminocyclopentyl]-N-(3,4-Dichlorophenyl)Propionamide; N,N-Didemethyleclanamine; N,N-Didesmethyleclanamine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 |
| CAS Registry Number | 116271-41-1 |
| SMILES | [C@H]2(N(C1=CC=C(Cl)C(=C1)Cl)C(=O)CC)[C@H](N)CCC2 |
| InChI | 1S/C14H18Cl2N2O/c1-2-14(19)18(13-5-3-4-12(13)17)9-6-7-10(15)11(16)8-9/h6-8,12-13H,2-5,17H2,1H3/t12-,13-/m1/s1 |
| InChIKey | QEASCXZVUQIDDJ-CHWSQXEVSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.089°C at 760 mmHg (Cal.) |
| Flash point | 218.144°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Didesmethyleclanamine |