|
CAS#: 1163-05-9 Product: Dibenz(a,j)Acridine N-Oxide No suppilers available for the product. |
| Name | Dibenz(a,j)Acridine N-Oxide |
|---|---|
| Synonyms | Dibenz(A,J)Acridine, 7-Oxide; Ccris 3316 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H13NO |
| Molecular Weight | 295.34 |
| CAS Registry Number | 1163-05-9 |
| SMILES | C4=CC3=[N+](C1=C(C2=C(C=C1)C=CC=C2)C=C3C5=C4C=CC=C5)[O-] |
| InChI | 1S/C21H13NO/c23-22-20-11-9-14-5-1-3-7-16(14)18(20)13-19-17-8-4-2-6-15(17)10-12-21(19)22/h1-13H |
| InChIKey | MQSWLCGJPFZPQJ-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.927°C at 760 mmHg (Cal.) |
| Flash point | 299.691°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenz(a,j)Acridine N-Oxide |