|
CAS#: 116409-24-6 Product: 6,7-Dimethyl-8-(3,4,5-Trimethoxyphenyl)-8H-Pyrano[6,5-f][1,3]Benzodioxole No suppilers available for the product. |
| Name | 6,7-Dimethyl-8-(3,4,5-Trimethoxyphenyl)-8H-Pyrano[6,5-f][1,3]Benzodioxole |
|---|---|
| Synonyms | 6,7-Dimethyl-8-(3,4,5-Trimethoxyphenyl)-8H-1,3-Dioxolo(4,5-G)(1)Benzopyran; Nsc381583; 8H-1,3-Dioxolo(4,5-G)(1)Benzopyran, 6,7-Dimethyl-8-(3,4,5-Trimethoxyphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 |
| CAS Registry Number | 116409-24-6 |
| SMILES | C2=C1OCOC1=CC4=C2C(C3=CC(=C(C(=C3)OC)OC)OC)C(=C(C)O4)C |
| InChI | 1S/C21H22O6/c1-11-12(2)27-15-9-17-16(25-10-26-17)8-14(15)20(11)13-6-18(22-3)21(24-5)19(7-13)23-4/h6-9,20H,10H2,1-5H3 |
| InChIKey | LDXJCLJHCJWUQF-UHFFFAOYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.679°C at 760 mmHg (Cal.) |
| Flash point | 183.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dimethyl-8-(3,4,5-Trimethoxyphenyl)-8H-Pyrano[6,5-f][1,3]Benzodioxole |