|
CAS#: 116596-29-3 Product: Decahydro-2,2,5,5-tetranitro-1,6:3,4-dimethanocyclobuta(1,2:3,4)dicyclopentene No suppilers available for the product. |
| Name | Decahydro-2,2,5,5-tetranitro-1,6:3,4-dimethanocyclobuta(1,2:3,4)dicyclopentene |
|---|---|
| Synonyms | 1,1,5,5-Tetranitro-(4)Peristylane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N4O8 |
| Molecular Weight | 340.25 |
| CAS Registry Number | 116596-29-3 |
| SMILES | O=[N+]([O-])C3([N+]([O-])=O)C5C1C4C2C1C(C([N+]([O-])=O)([N+]([O-])=O)C2CC34)C5 |
| InChI | 1S/C12H12N4O8/c17-13(18)11(14(19)20)3-1-4-8-7(3)9-5(11)2-6(10(8)9)12(4,15(21)22)16(23)24/h3-10H,1-2H2 |
| InChIKey | DPEXIVBHDYTQSN-UHFFFAOYSA-N |
| Density | 1.824g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.117°C at 760 mmHg (Cal.) |
| Flash point | 310.314°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Decahydro-2,2,5,5-tetranitro-1,6:3,4-dimethanocyclobuta(1,2:3,4)dicyclopentene |