|
CAS#: 116795-97-2 Product: Ledazerol No suppilers available for the product. |
| Name | Ledazerol |
|---|---|
| Synonyms | 2-(3H-Imidazol-4-Ylmethyl)-6-Methylol-Phenol; 2-Hydroxy-3-(1H-Imidazol-4-Ylmethyl)Benzenemethanol; 2-Hydroxy-3-(Imidazol-4-Ylmethyl)Benzyl Alcohol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 |
| CAS Registry Number | 116795-97-2 |
| SMILES | C1=NC=C([NH]1)CC2=C(C(=CC=C2)CO)O |
| InChI | 1S/C11H12N2O2/c14-6-9-3-1-2-8(11(9)15)4-10-5-12-7-13-10/h1-3,5,7,14-15H,4,6H2,(H,12,13) |
| InChIKey | PGVXBSSEVQUMQM-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.5°C at 760 mmHg (Cal.) |
| Flash point | 254.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ledazerol |