|
CAS#: 1169-60-4 Product: Methyl 8-Methoxy-6-Nitronaphtho[2,1-g][1,3]Benzodioxole-5-Carboxylate No suppilers available for the product. |
| Name | Methyl 8-Methoxy-6-Nitronaphtho[2,1-g][1,3]Benzodioxole-5-Carboxylate |
|---|---|
| Synonyms | Methyl 8-Methoxy-6-Nitro-Naphtho[2,1-G][1,3]Benzodioxole-5-Carboxylate; 8-Methoxy-6-Nitro-5-Naphtho[2,1-G][1,3]Benzodioxolecarboxylic Acid Methyl Ester; 8-Methoxy-6-Nitro-Naphtho[2,1-G][1,3]Benzodioxole-5-Carboxylic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H13NO7 |
| Molecular Weight | 355.30 |
| CAS Registry Number | 1169-60-4 |
| SMILES | C1=C([N+]([O-])=O)C4=C(C2=CC=CC(=C12)OC)C3=C(OCO3)C=C4C(OC)=O |
| InChI | 1S/C18H13NO7/c1-23-13-5-3-4-9-10(13)6-12(19(21)22)15-11(18(20)24-2)7-14-17(16(9)15)26-8-25-14/h3-7H,8H2,1-2H3 |
| InChIKey | RZUABJWVTLHGHJ-UHFFFAOYSA-N |
| Density | 1.465g/cm3 (Cal.) |
|---|---|
| Boiling point | 567.68°C at 760 mmHg (Cal.) |
| Flash point | 250.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 8-Methoxy-6-Nitronaphtho[2,1-g][1,3]Benzodioxole-5-Carboxylate |