|
CAS#: 117-86-2 Product: 3-Nitronaphthalene-1,5-Disulfonic Acid No suppilers available for the product. |
| Name | 3-Nitronaphthalene-1,5-Disulfonic Acid |
|---|---|
| Synonyms | 1,5-Naphthalenedisulfonic Acid, 3-Nitro-; 3-Nitronaphthalene-1,5-Disulphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7NO8S2 |
| Molecular Weight | 333.29 |
| CAS Registry Number | 117-86-2 |
| EINECS | 204-216-8 |
| SMILES | C2=C([S](=O)(=O)O)C1=C(C(=CC=C1)[S](=O)(=O)O)C=C2[N+]([O-])=O |
| InChI | 1S/C10H7NO8S2/c12-11(13)6-4-8-7(10(5-6)21(17,18)19)2-1-3-9(8)20(14,15)16/h1-5H,(H,14,15,16)(H,17,18,19) |
| InChIKey | YDPFPDNDNZUKPL-UHFFFAOYSA-N |
| Density | 1.842g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Nitronaphthalene-1,5-Disulfonic Acid |