|
CAS#: 1170-38-3 Product: 2-(2-Carboxy-4-Nitrophenyl)Disulfanyl-5-Nitrobenzoic Acid No suppilers available for the product. |
| Name | 2-(2-Carboxy-4-Nitrophenyl)Disulfanyl-5-Nitrobenzoic Acid |
|---|---|
| Synonyms | 2-(2-Carboxy-4-Nitro-Phenyl)Disulfanyl-5-Nitro-Benzoic Acid; Nsc517871 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8N2O8S2 |
| Molecular Weight | 396.35 |
| CAS Registry Number | 1170-38-3 |
| SMILES | C1=C(C(=CC(=C1)[N+](=O)[O-])C(O)=O)SSC2=C(C=C([N+](=O)[O-])C=C2)C(O)=O |
| InChI | 1S/C14H8N2O8S2/c17-13(18)9-5-7(15(21)22)1-3-11(9)25-26-12-4-2-8(16(23)24)6-10(12)14(19)20/h1-6H,(H,17,18)(H,19,20) |
| InChIKey | DUXMDNPYAFSEDK-UHFFFAOYSA-N |
| Density | 1.787g/cm3 (Cal.) |
|---|---|
| Boiling point | 626.055°C at 760 mmHg (Cal.) |
| Flash point | 332.427°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Carboxy-4-Nitrophenyl)Disulfanyl-5-Nitrobenzoic Acid |