Online Database of Chemicals from Around the World
|
CAS#: 1173-75-7 Product: Bis(2,3,4,5,6-Pentachlorophenyl) Oxalate No suppilers available for the product. |
| Name | Bis(2,3,4,5,6-Pentachlorophenyl) Oxalate |
|---|---|
| Synonyms | Oxalic Acid Bis(2,3,4,5,6-Pentachlorophenyl) Ester; Bis(2,3,4,5,6-Pentachlorophenyl) Ethanedioate; B-Pcpo |
| Molecular Structure |  |
| Molecular Formula | C14Cl10O4 |
| Molecular Weight | 586.68 |
| CAS Registry Number | 1173-75-7 |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)OC(C(OC2=C(C(=C(Cl)C(=C2Cl)Cl)Cl)Cl)=O)=O |
| InChI | 1S/C14Cl10O4/c15-1-3(17)7(21)11(8(22)4(1)18)27-13(25)14(26)28-12-9(23)5(19)2(16)6(20)10(12)24 |
| InChIKey | OXTSSJOQCJZYLA-UHFFFAOYSA-N |
| Density | 1.88g/cm3 (Cal.) |
|---|---|
| Boiling point | 598.309°C at 760 mmHg (Cal.) |
| Flash point | 216.589°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2,3,4,5,6-Pentachlorophenyl) Oxalate |