| Abcam | USA | Inquire | ||
|---|---|---|---|---|
![]() |
us.orders@abcam.com | |||
| Chemical manufacturer since 1998 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | (2R)-4-[(2E)-3-Phosphono-2-Propenyl]-2-Piperazinecarboxylicacid |
|---|---|
| Synonyms | (2R)-4-[(E)-3-Phosphonoprop-2-Enyl]-2-Piperazinecarboxylic Acid; Ncgc00092278-01; Sdz-Eaa-494 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15N2O5P |
| Molecular Weight | 250.19 |
| CAS Registry Number | 117414-74-1 |
| SMILES | [C@H]1(NCCN(C1)C/C=C/[P](=O)(O)O)C(=O)O |
| InChI | 1S/C8H15N2O5P/c11-8(12)7-6-10(4-2-9-7)3-1-5-16(13,14)15/h1,5,7,9H,2-4,6H2,(H,11,12)(H2,13,14,15)/b5-1+/t7-/m1/s1 |
| InChIKey | VZXMZMJSGLFKQI-ABVWVHJUSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.629°C at 760 mmHg (Cal.) |
| Flash point | 289.835°C (Cal.) |
| solubility | Soluble to 100 mM in water |
| Market Analysis Reports |
| List of Reports Available for (2R)-4-[(2E)-3-Phosphono-2-Propenyl]-2-Piperazinecarboxylicacid |