|
CAS#: 117736-18-2 Product: 1-(trans-4-Heptylcyclohexyl)-4-{2-[trans-4-(4-Isothiocyanatophenyl)Cyclohexyl]Ethyl}Benzene No suppilers available for the product. |
| Name | 1-(trans-4-Heptylcyclohexyl)-4-{2-[trans-4-(4-Isothiocyanatophenyl)Cyclohexyl]Ethyl}Benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C34H47NS |
| Molecular Weight | 501.81 |
| CAS Registry Number | 117736-18-2 |
| SMILES | S=C=N/c1ccc(cc1)[C@H]2CC[C@@H](CC2)CCc3ccc(cc3)[C@@H]4CC[C@@H](CCCCCCC)CC4 |
| InChI | 1S/C34H47NS/c1-2-3-4-5-6-7-27-10-16-30(17-11-27)31-18-12-28(13-19-31)8-9-29-14-20-32(21-15-29)33-22-24-34(25-23-33)35-26-36/h12-13,18-19,22-25,27,29-30,32H,2-11,14-17,20-21H2,1H3/t27-,29-,30-,32- |
| InChIKey | GBOGSORKZCCKOJ-OPDLBQQDSA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 621.641°C at 760 mmHg (Cal.) |
| Flash point | 364.457°C (Cal.) |
| Refractive index | 1.581 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(trans-4-Heptylcyclohexyl)-4-{2-[trans-4-(4-Isothiocyanatophenyl)Cyclohexyl]Ethyl}Benzene |