|
CAS#: 118160-59-1 Product: 7-O-Ethyl fangchinoline No suppilers available for the product. |
| Name | 7-O-Ethyl fangchinoline |
|---|---|
| Synonyms | 7-O-Efc; 7-O-Ethyl Fangchinoline; 7-O-Ethylfangchinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C39H44N2O6 |
| Molecular Weight | 636.79 |
| CAS Registry Number | 118160-59-1 |
| SMILES | [C@@H]16N(CCC2=C1C(=C(OCC)C(=C2)OC)OC3=CC4=C(C=C3OC)CCN([C@H]4CC7=CC=C(OC5=C(OC)C=CC(=C5)C6)C=C7)C)C |
| InChI | 1S/C39H44N2O6/c1-7-45-38-36(44-6)22-27-15-17-41(3)31-19-25-10-13-32(42-4)34(20-25)46-28-11-8-24(9-12-28)18-30-29-23-35(47-39(38)37(27)31)33(43-5)21-26(29)14-16-40(30)2/h8-13,20-23,30-31H,7,14-19H2,1-6H3/t30-,31-/m0/s1 |
| InChIKey | VNBSKOLSTYLJBG-CONSDPRKSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 719.143°C at 760 mmHg (Cal.) |
| Flash point | 175.764°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-O-Ethyl fangchinoline |