|
CAS#: 1186-34-1 Product: (2S)-2-Amino-3-(2-Aminoethoxy-Hydroxyphosphoryl)Oxypropanoic Acid No suppilers available for the product. |
| Name | (2S)-2-Amino-3-(2-Aminoethoxy-Hydroxyphosphoryl)Oxypropanoic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-3-(2-Aminoethoxy-Hydroxy-Phosphoryl)Oxy-Propanoic Acid; (2S)-2-Amino-3-(2-Aminoethoxy-Hydroxy-Phosphoryl)Oxy-Propionic Acid; C03872 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H13N2O6P |
| Molecular Weight | 228.14 |
| CAS Registry Number | 1186-34-1 |
| SMILES | [C@H](C(=O)O)(N)CO[P](OCCN)(O)=O |
| InChI | 1S/C5H13N2O6P/c6-1-2-12-14(10,11)13-3-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | UQDJGEHQDNVPGU-BYPYZUCNSA-N |
| Density | 1.544g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.983°C at 760 mmHg (Cal.) |
| Flash point | 218.684°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-3-(2-Aminoethoxy-Hydroxyphosphoryl)Oxypropanoic Acid |