|
CAS#: 118817-61-1 Product: 1-[2-(2,4-Dichlorophenyl)Pentyl]-1H-1,2,4-Triazole No suppilers available for the product. |
| Name | 1-[2-(2,4-Dichlorophenyl)Pentyl]-1H-1,2,4-Triazole |
|---|---|
| Synonyms | 1-[2- -n-pentyl]-1H-1,2,4-triazole; 1-[2-(2,4-Dichlorophenyl)-n-pentyl]-1H-1,2,4-triazole; 1-[2-(2,4-dichlorophenyl)pentyl]-1,2,4-triazole |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.18 |
| CAS Registry Number | 118817-61-1 |
| SMILES | CCCC(CN1C=NC=N1)C2=C(C=C(C=C2)Cl)Cl |
| InChI | 1S/C13H15Cl2N3/c1-2-3-10(7-18-9-16-8-17-18)12-5-4-11(14)6-13(12)15/h4-6,8-10H,2-3,7H2,1H3 |
| InChIKey | WKBPZYKAUNRMKP-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.3±55.0°C at 760 mmHg (Cal.) |
| Flash point | 204.9±31.5°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(2,4-Dichlorophenyl)Pentyl]-1H-1,2,4-Triazole |