|
CAS#: 118869-52-6 Product: 2-Desamino-2-Methylaminopterin No suppilers available for the product. |
| Name | 2-Desamino-2-Methylaminopterin |
|---|---|
| Synonyms | (2S)-2-[[4-[(4-Amino-2-Methyl-Pteridin-6-Yl)Methylamino]Benzoyl]Amino]Pentanedioic Acid; (2S)-2-[[[4-[(4-Amino-2-Methyl-6-Pteridinyl)Methylamino]Phenyl]-Oxomethyl]Amino]Pentanedioic Acid; (2S)-2-[[4-[(4-Amino-2-Methyl-Pteridin-6-Yl)Methylamino]Benzoyl]Amino]Glutaric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21N7O5 |
| Molecular Weight | 439.43 |
| CAS Registry Number | 118869-52-6 |
| SMILES | [C@@H](NC(=O)C3=CC=C(NCC2=NC1=C(N=C(N=C1N=C2)C)N)C=C3)(C(=O)O)CCC(=O)O |
| InChI | 1S/C20H21N7O5/c1-10-24-17(21)16-18(25-10)23-9-13(26-16)8-22-12-4-2-11(3-5-12)19(30)27-14(20(31)32)6-7-15(28)29/h2-5,9,14,22H,6-8H2,1H3,(H,27,30)(H,28,29)(H,31,32)(H2,21,23,24,25)/t14-/m0/s1 |
| InChIKey | XOSWZVVCHBBRAM-AWEZNQCLSA-N |
| Density | 1.509g/cm3 (Cal.) |
|---|---|
| Boiling point | 716.841°C at 760 mmHg (Cal.) |
| Flash point | 387.332°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Desamino-2-Methylaminopterin |