|
CAS#: 118878-53-8 Product: Methyl D-Alloisoleucinate No suppilers available for the product. |
| Name | Methyl D-Alloisoleucinate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 |
| CAS Registry Number | 118878-53-8 |
| SMILES | O=C(OC)[C@H](N)[C@H](CC)C |
| InChI | 1S/C7H15NO2/c1-4-5(2)6(8)7(9)10-3/h5-6H,4,8H2,1-3H3/t5-,6+/m0/s1 |
| InChIKey | YXMMTUJDQTVJEN-NTSWFWBYSA-N |
| Density | 0.955g/cm3 (Cal.) |
|---|---|
| Boiling point | 169.203°C at 760 mmHg (Cal.) |
| Flash point | 42.685°C (Cal.) |
| Refractive index | 1.436 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl D-Alloisoleucinate |