|
CAS#: 118993-61-6 Product: 4-(4-Methoxybenzoyl)-2-Furansulfonamide No suppilers available for the product. |
| Name | 4-(4-Methoxybenzoyl)-2-Furansulfonamide |
|---|---|
| Synonyms | 4-(4-Methoxy-benzoyl)-furan-2-sulfonic acid amide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NO5S |
| Molecular Weight | 281.28 |
| CAS Registry Number | 118993-61-6 |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=COC(=C2)S(=O)(=O)N |
| InChI | 1S/C12H11NO5S/c1-17-10-4-2-8(3-5-10)12(14)9-6-11(18-7-9)19(13,15)16/h2-7H,1H3,(H2,13,15,16) |
| InChIKey | OIEIIZQFSICKJF-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 512.2±60.0°C at 760 mmHg (Cal.) |
| Flash point | 263.6±32.9°C (Cal.) |
| Refractive index | 1.578 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Methoxybenzoyl)-2-Furansulfonamide |