|
CAS#: 119036-18-9 Product: 2,2',4,4',5-Pentachlorodiphenyl Ether No suppilers available for the product. |
| Name | 2,2',4,4',5-Pentachlorodiphenyl Ether |
|---|---|
| Synonyms | Dichloro(2,4,5-Trichlorophenoxy)Phenol; Pcde; Phenol, Dichloro(2,4,5-Trichlorophenoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Cl5O2 |
| Molecular Weight | 358.44 |
| CAS Registry Number | 119036-18-9 |
| SMILES | C1=C(C(=C(C(=C1)O)OC2=CC(=C(C=C2Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H5Cl5O2/c13-5-1-2-9(18)12(11(5)17)19-10-4-7(15)6(14)3-8(10)16/h1-4,18H |
| InChIKey | YZZVJTZVYYIQCB-UHFFFAOYSA-N |
| Density | 1.643g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.599°C at 760 mmHg (Cal.) |
| Flash point | 186.399°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',4,4',5-Pentachlorodiphenyl Ether |