| Alfa Pyridines | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| Name | Besipirdine |
|---|---|
| Synonyms | N-Propyl-N-(4-Pyridyl)Indol-1-Amine; N-Propyl-N-(4-Pyridyl)-1-Indolamine; Indol-1-Yl-Propyl-(4-Pyridyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 |
| CAS Registry Number | 119257-34-0 |
| SMILES | C1=CC3=C([N]1N(C2=CC=NC=C2)CCC)C=CC=C3 |
| InChI | 1S/C16H17N3/c1-2-12-18(15-7-10-17-11-8-15)19-13-9-14-5-3-4-6-16(14)19/h3-11,13H,2,12H2,1H3 |
| InChIKey | OTPPJICEBWOCKD-UHFFFAOYSA-N |
| Density | 1.092g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.873°C at 760 mmHg (Cal.) |
| Flash point | 199.265°C (Cal.) |
| (1) | HUFF F. J.. Preliminary Evaluation of Besipirdine for the Treatment of Alzheimer's Diseasea, Annals of the New York Academy of Sciences, 1996 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Besipirdine |