|
CAS#: 119514-66-8 Product: 1-[Di(Phenyl)Methyl]-4-[[5-Methyl-2-(4-Methylphenyl)-1H-Imidazol-4-Yl]Methyl]Piperazine No suppilers available for the product. |
| Name | 1-[Di(Phenyl)Methyl]-4-[[5-Methyl-2-(4-Methylphenyl)-1H-Imidazol-4-Yl]Methyl]Piperazine |
|---|---|
| Synonyms | D04735; Lifarizine (Usan); 1-(Diphenylmethyl)-4-((5-Methyl-2-P-Tolylimidazol-4-Yl)Methyl)Piperazine |
| Molecular Structure | ![]() |
| Molecular Formula | C29H32N4 |
| Molecular Weight | 436.60 |
| CAS Registry Number | 119514-66-8 |
| SMILES | C5=C(C(N3CCN(CC1=C([NH]C(=N1)C2=CC=C(C)C=C2)C)CC3)C4=CC=CC=C4)C=CC=C5 |
| InChI | 1S/C29H32N4/c1-22-13-15-26(16-14-22)29-30-23(2)27(31-29)21-32-17-19-33(20-18-32)28(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-16,28H,17-21H2,1-2H3,(H,30,31) |
| InChIKey | HTDFEXRUDGWNHA-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.867°C at 760 mmHg (Cal.) |
| Flash point | 324.451°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[Di(Phenyl)Methyl]-4-[[5-Methyl-2-(4-Methylphenyl)-1H-Imidazol-4-Yl]Methyl]Piperazine |