|
CAS#: 119631-00-4 Product: 3,3'-Diamino-4,4'-dimethylazobenzene No suppilers available for the product. |
| Name | 3,3'-Diamino-4,4'-dimethylazobenzene |
|---|---|
| Synonyms | 5-(3-Amino-4-Methyl-Phenyl)Azo-2-Methyl-Aniline; 5-(3-Amino-4-Methylphenyl)Azo-2-Methylaniline; [5-(3-Amino-4-Methyl-Phenyl)Azo-2-Methyl-Phenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 |
| CAS Registry Number | 119631-00-4 |
| SMILES | C2=C(N=NC1=CC(=C(C=C1)C)N)C=CC(=C2N)C |
| InChI | 1S/C14H16N4/c1-9-3-5-11(7-13(9)15)17-18-12-6-4-10(2)14(16)8-12/h3-8H,15-16H2,1-2H3 |
| InChIKey | MOANQCLTXTXKAF-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.59°C at 760 mmHg (Cal.) |
| Flash point | 243.847°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Diamino-4,4'-dimethylazobenzene |