|
CAS#: 1198-56-7 Product: 1,2,3,5-Tetrachloro-4,6-Difluorobenzene No suppilers available for the product. |
| Name | 1,2,3,5-Tetrachloro-4,6-Difluorobenzene |
|---|---|
| Synonyms | 1,2,3,5-Tetrachloro-4,6-difluorobenzene # |
| Molecular Structure | ![]() |
| Molecular Formula | C6Cl4F2 |
| Molecular Weight | 251.87 |
| CAS Registry Number | 1198-56-7 |
| SMILES | Fc1c(Cl)c(F)c(Cl)c(Cl)c1Cl |
| InChI | 1S/C6Cl4F2/c7-1-2(8)5(11)4(10)6(12)3(1)9 |
| InChIKey | PVGPCHMQECZTIK-UHFFFAOYSA-N |
| Density | 1.729g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.246°C at 760 mmHg (Cal.) |
| Flash point | 111.316°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,5-Tetrachloro-4,6-Difluorobenzene |