|
CAS#: 119816-53-4 Product: Methyl 2,4,6-Trideoxy-2,4-Di-C-Methylgluohexopyranoside No suppilers available for the product. |
| Name | Methyl 2,4,6-Trideoxy-2,4-Di-C-Methylgluohexopyranoside |
|---|---|
| Synonyms | (2R,3R,4S,5R,6S)-2-Methoxy-3,5,6-Trimethyl-Tetrahydropyran-4-Ol; (2R,3R,4S,5R,6S)-2-Methoxy-3,5,6-Trimethyl-4-Tetrahydropyranol; (2R,3R,4S,5R,6S)-2-Methoxy-3,5,6-Trimethyl-Oxan-4-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 |
| CAS Registry Number | 119816-53-4 |
| SMILES | [C@@H]1([C@@H]([C@H]([C@H]([C@@H](O1)C)C)O)C)OC |
| InChI | 1S/C9H18O3/c1-5-7(3)12-9(11-4)6(2)8(5)10/h5-10H,1-4H3/t5-,6+,7-,8-,9+/m0/s1 |
| InChIKey | NHTOFHVXFDQMGQ-QKAWAISNSA-N |
| Density | 1.013g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.443°C at 760 mmHg (Cal.) |
| Flash point | 106.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,4,6-Trideoxy-2,4-Di-C-Methylgluohexopyranoside |