|
CAS#: 120100-04-1 Product: Methyl 2-Chloro-3-Methyl-4-(Methylsulfonyl)Benzoate No suppilers available for the product. |
| Name | Methyl 2-Chloro-3-Methyl-4-(Methylsulfonyl)Benzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClO4S |
| Molecular Weight | 262.71 |
| CAS Registry Number | 120100-04-1 |
| SMILES | Cc1c(ccc(C(=O)OC)c1Cl)S(C)(=O)=O |
| InChI | 1S/C10H11ClO4S/c1-6-8(16(3,13)14)5-4-7(9(6)11)10(12)15-2/h4-5H,1-3H3 |
| InChIKey | BBWCBPYXCNCYAT-UHFFFAOYSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.442°C at 760 mmHg (Cal.) |
| Flash point | 215.333°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Chloro-3-Methyl-4-(Methylsulfonyl)Benzoate |