|
CAS#: 120167-25-1 Product: 2-[(1E,3E)-Hexa-1,3-Dienyl]-2,6-Dimethyl-5,6-Dihydrofuro[5,4-b]Pyran-3,4-Dione No suppilers available for the product. |
| Name | 2-[(1E,3E)-Hexa-1,3-Dienyl]-2,6-Dimethyl-5,6-Dihydrofuro[5,4-b]Pyran-3,4-Dione |
|---|---|
| Synonyms | 2-[(1E,3E)-Hexa-1,3-Dienyl]-2,6-Dimethyl-5,6-Dihydrofuro[5,4-B]Pyran-3,4-Quinone; 4H-Furo(2,3-B)Pyran-3,4(2H)-Dione, 2-(1,3-Hexadienyl)-5,6-Dihydro-2,6-Dimethyl-; Cyclogregatin |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 |
| CAS Registry Number | 120167-25-1 |
| SMILES | C(/C=C/C=C/C1(OC2=C(C1=O)C(=O)CC(O2)C)C)C |
| InChI | 1S/C15H18O4/c1-4-5-6-7-8-15(3)13(17)12-11(16)9-10(2)18-14(12)19-15/h5-8,10H,4,9H2,1-3H3/b6-5+,8-7+ |
| InChIKey | CELZYTLJFHLTOR-BSWSSELBSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.457°C at 760 mmHg (Cal.) |
| Flash point | 167.364°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(1E,3E)-Hexa-1,3-Dienyl]-2,6-Dimethyl-5,6-Dihydrofuro[5,4-b]Pyran-3,4-Dione |