Online Database of Chemicals from Around the World
|
CAS#: 1203-40-3 Product: Benzene-1,2-Dicarboperoxoic Acid No suppilers available for the product. |
| Name | Benzene-1,2-Dicarboperoxoic Acid |
|---|---|
| Synonyms | Dioxyphthalic Acid; 1,2-Benzenedicarboperoxoic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 |
| CAS Registry Number | 1203-40-3 |
| EINECS | 214-870-6 |
| SMILES | C1=C(C(=CC=C1)C(=O)OO)C(=O)OO |
| InChI | 1S/C8H6O6/c9-7(13-11)5-3-1-2-4-6(5)8(10)14-12/h1-4,11-12H |
| InChIKey | DRZOELSSQWENBA-UHFFFAOYSA-N |
| Density | 1.557g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.609°C at 760 mmHg (Cal.) |
| Flash point | 183.94°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzene-1,2-Dicarboperoxoic Acid |