|
CAS#: 120302-30-9 Product: 2-(6-Nitro-1H-Indol-3-Yl)Ethanol No suppilers available for the product. |
| Name | 2-(6-Nitro-1H-Indol-3-Yl)Ethanol |
|---|---|
| Synonyms | 1H-Indole-3-Ethanol, 6-Nitro-; 6-Nitro-1H-Indole-3-Ethanol; 6-Nitrotryptophol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 |
| CAS Registry Number | 120302-30-9 |
| SMILES | C1=C([N+]([O-])=O)C=CC2=C1[NH]C=C2CCO |
| InChI | 1S/C10H10N2O3/c13-4-3-7-6-11-10-5-8(12(14)15)1-2-9(7)10/h1-2,5-6,11,13H,3-4H2 |
| InChIKey | WFCUGFZWUAOXQR-UHFFFAOYSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.891°C at 760 mmHg (Cal.) |
| Flash point | 227.096°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(6-Nitro-1H-Indol-3-Yl)Ethanol |