Online Database of Chemicals from Around the World
|
CAS#: 1204-69-9 Product: 4-[Bis(2-Chloroethyl)Amino]Phenol No suppilers available for the product. |
| Name | 4-[Bis(2-Chloroethyl)Amino]Phenol |
|---|---|
| Synonyms | Nciopen2_004170; 4-13-00-01047 (Beilstein Handbook Reference); Brn 2212728 |
| Molecular Structure | ![CAS#: 1204-69-9, 4-[Bis(2-Chloroethyl)Amino]Phenol](/moreStructures/1204-69-9.gif) |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.12 |
| CAS Registry Number | 1204-69-9 |
| SMILES | C1=C(N(CCCl)CCCl)C=CC(=C1)O |
| InChI | 1S/C10H13Cl2NO/c11-5-7-13(8-6-12)9-1-3-10(14)4-2-9/h1-4,14H,5-8H2 |
| InChIKey | WRVLEDLJKOSANT-UHFFFAOYSA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.089°C at 760 mmHg (Cal.) |
| Flash point | 183.672°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Bis(2-Chloroethyl)Amino]Phenol |