|
CAS#: 120418-68-0 Product: 2-(4-Chlorophenyl)-4-Aminobutyric Acid No suppilers available for the product. |
| Name | 2-(4-Chlorophenyl)-4-Aminobutyric Acid |
|---|---|
| Synonyms | [3-(4-Chlorophenyl)-4-Hydroxy-4-Oxo-Butyl]Ammonium Chloride; [3-(4-Chlorophenyl)-4-Hydroxy-4-Oxobutyl]Ammonium Chloride; [3-(4-Chlorophenyl)-4-Hydroxy-4-Keto-Butyl]Ammonium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 |
| CAS Registry Number | 120418-68-0 |
| SMILES | C1=CC(=CC=C1Cl)C(CC[NH3+])C(O)=O.[Cl-] |
| InChI | 1S/C10H12ClNO2.ClH/c11-8-3-1-7(2-4-8)9(5-6-12)10(13)14;/h1-4,9H,5-6,12H2,(H,13,14);1H |
| InChIKey | OBHYSBMAJPVQKX-UHFFFAOYSA-N |
| Boiling point | 365.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-4-Aminobutyric Acid |