| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | (7E)-1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-7-Hexadecene |
|---|---|
| Synonyms | 1-(Perfluorohexyl)dec-1-ene; 1-(Perfluorohexyl)dec-1-ene 95% |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19F13 |
| Molecular Weight | 458.30 |
| CAS Registry Number | 120464-27-9 |
| SMILES | FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)/C=C/CCCCCCCC |
| InChI | 1S/C16H19F13/c1-2-3-4-5-6-7-8-9-10-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h9-10H,2-8H2,1H3/b10-9+ |
| InChIKey | UFXJXRIUXCGTRG-MDZDMXLPSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.61°C at 760 mmHg (Cal.) |
| Flash point | 112.669°C (Cal.) |
| Refractive index | 1.356 (Cal.) |
| Safety Description | Irritant |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (7E)-1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-7-Hexadecene |