|
CAS#: 120551-57-7 Product: 1,1,3-Trimethyl-3-(3'-Indolyl)-1,2,3,4-Tetrahydrocyclopent(b)Indole No suppilers available for the product. |
| Name | 1,1,3-Trimethyl-3-(3'-Indolyl)-1,2,3,4-Tetrahydrocyclopent(b)Indole |
|---|---|
| Synonyms | 1,1,3-Trimethyl-3-(3'-Indolyl)-1,2,3,4-Tetrahydrocyclopent(B)Indole; 3-(1H-Indol-3-Yl)-1,1,3-Trimethyl-1,2,3,4-Tetrahydro-Cyclopent(B)Indole; Cyclopent(B)Indole, 1,2,3,4-Tetrahydro-3-(1H-Indol-3-Yl)-1,1,3-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 |
| CAS Registry Number | 120551-57-7 |
| SMILES | C1=CC=CC5=C1C4=C(C(C2=C[NH]C3=C2C=CC=C3)(CC4(C)C)C)[NH]5 |
| InChI | 1S/C22H22N2/c1-21(2)13-22(3,16-12-23-17-10-6-4-8-14(16)17)20-19(21)15-9-5-7-11-18(15)24-20/h4-12,23-24H,13H2,1-3H3 |
| InChIKey | ZYVXSIBDWSNRFA-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.709°C at 760 mmHg (Cal.) |
| Flash point | 230.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3-Trimethyl-3-(3'-Indolyl)-1,2,3,4-Tetrahydrocyclopent(b)Indole |