|
CAS#: 120806-32-8 Product: Phenyltrope No suppilers available for the product. |
| Name | Phenyltrope |
|---|---|
| Synonyms | N-Ethyl-3-Hydroxy-2-Phenyl-N-(4-Pyridylmethyl)Propanamide; 3-[(1R)-1-Hydroxy-2-Methylamino-Ethyl]Phenol; N-Ethyl-3-Hydroxy-2-Phenyl-N-(4-Pyridylmethyl)Propanamide; 3-[(1R)-1-Hydroxy-2-Methylaminoethyl]Phenol; N-Ethyl-3-Hydroxy-2-Phenyl-N-(4-Pyridylmethyl)Propionamide; 3-[(1R)-1-Hydroxy-2-Methylamino-Ethyl]Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.56 |
| CAS Registry Number | 120806-32-8 |
| SMILES | [C@@H](O)(C1=CC=CC(=C1)O)CNC.C3=C(C(C(=O)N(CC2=CC=NC=C2)CC)CO)C=CC=C3 |
| InChI | 1S/C17H20N2O2.C9H13NO2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15;1-10-6-9(12)7-3-2-4-8(11)5-7/h3-11,16,20H,2,12-13H2,1H3;2-5,9-12H,6H2,1H3/t;9-/m.0/s1 |
| InChIKey | XHIWPLXFWGZVOP-NPULLEENSA-N |
| Boiling point | 492.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 251.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyltrope |